| Name | 2-Methyl-1-nitronaphthalene |
| Synonyms | NSC 7516 CCRIS 4680 BRN 1954310 2-METHYL-1-NITROPHTHALENE 2-Methyl-1-nitronaphthalene 2-METHYL-1-NITRONAPHTHALENE 1-NITRO-2-METHYLNAPHTHALENE 2-methyl-1-nitro-naphthalen 1-Nitro-2-methylnaphthalene Naphthalene, 2-methyl-1-nitro- Naphthalene, 2-Methyl-1-nitro- 4-05-00-01698 (Beilstein Handbook Reference) |
| CAS | 881-03-8 |
| EINECS | 212-917-5 |
| InChI | InChI=1/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| InChIKey | IZNWACYOILBFEG-UHFFFAOYSA-N |
| Molecular Formula | C11H9NO2 |
| Molar Mass | 187.19 |
| Density | 1.1963 (rough estimate) |
| Melting Point | 79-82°C(lit.) |
| Boling Point | 185-186°C18mm Hg(lit.) |
| Flash Point | 150.4°C |
| Vapor Presure | 0.000594mmHg at 25°C |
| Appearance | powder to crystal |
| Color | Light yellow to Amber to Dark green |
| BRN | 1954310 |
| Storage Condition | Keep in dark place,Sealed in dry,Room Temperature |
| Refractive Index | 1.4900 (estimate) |
| MDL | MFCD00003914 |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S22 - Do not breathe dust. S24/25 - Avoid contact with skin and eyes. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. |
| WGK Germany | 3 |
| RTECS | QJ9708200 |
| FLUKA BRAND F CODES | 8 |
| HS Code | 29042090 |
| Hazard Note | Irritant |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |